| Name | Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II) |
| Synonyms | Pd-117 bis(diphenylphosphinophenyl)etherpalladium(II)... Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II) Bis(diphenylphosphinophenyl)ether palladium (II) dichloride Dichloro[bis(2-(diphenylphosphino)phenyl)ether]palladium(II) cis-[Bis[2-(diphenylphosphino)phenyl] ether]dichloropalladium Bis(diphenylphosphinophenyl)ether palladium (II) dichloride |
| CAS | 205319-06-8 |
| InChI | InChI=1/C36H28OP2.2ClH.Pd/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32;;;/h1-28H;2*1H;/q;;;+2/p-2 |
| Molecular Formula | C36H28Cl2OP2Pd |
| Molar Mass | 717.9 |
| Melting Point | 243-250°C |
| Boling Point | 608.2°C at 760 mmHg |
| Flash Point | 404.9°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 4.35E-14mmHg at 25°C |
| Appearance | Powder |
| Color | yellow |
| Storage Condition | 2-8°C |
| MDL | MFCD09953446 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37 - Wear suitable gloves. |
| WGK Germany | 3 |
| TSCA | No |